N-[(4-fluorophenyl)methyl]-2-(1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-(1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
N-[(4-fluorophenyl)methyl]-2-(1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
Compound characteristics
| Compound ID: | C786-0102 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-(1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide |
| Molecular Weight: | 350.35 |
| Molecular Formula: | C19 H15 F N4 O2 |
| Smiles: | C(c1ccc(cc1)F)NC(CN1C(c2cc3ccccc3n2C=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9915 |
| logD: | 1.9915 |
| logSw: | -2.7758 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.155 |
| InChI Key: | HLOMLWBHIFYLNB-UHFFFAOYSA-N |