N-cyclopropyl-2-(9-methoxy-4-methyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
Chemical Structure Depiction of
N-cyclopropyl-2-(9-methoxy-4-methyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
N-cyclopropyl-2-(9-methoxy-4-methyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide
Compound characteristics
| Compound ID: | C786-2450 |
| Compound Name: | N-cyclopropyl-2-(9-methoxy-4-methyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)acetamide |
| Molecular Weight: | 326.35 |
| Molecular Formula: | C17 H18 N4 O3 |
| Smiles: | CC1=NN(CC(NC2CC2)=O)C(c2cc3c(cccc3n12)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5223 |
| logD: | 1.5223 |
| logSw: | -2.2613 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.534 |
| InChI Key: | JJZDZZFNVKZVCQ-UHFFFAOYSA-N |