N-(5-chloro-2-methoxyphenyl)-2-(4H-furo[3,2-b]pyrrole-5-carbonyl)hydrazine-1-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-2-(4H-furo[3,2-b]pyrrole-5-carbonyl)hydrazine-1-carboxamide
N-(5-chloro-2-methoxyphenyl)-2-(4H-furo[3,2-b]pyrrole-5-carbonyl)hydrazine-1-carboxamide
Compound characteristics
| Compound ID: | C791-0986 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-2-(4H-furo[3,2-b]pyrrole-5-carbonyl)hydrazine-1-carboxamide |
| Molecular Weight: | 348.74 |
| Molecular Formula: | C15 H13 Cl N4 O4 |
| Smiles: | COc1ccc(cc1NC(NNC(c1cc2c(cco2)[nH]1)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 1.9475 |
| logD: | 1.8251 |
| logSw: | -2.7768 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 85.4 |
| InChI Key: | UKSRECJRJUNMLG-UHFFFAOYSA-N |