2-(5-methyl-8-oxofuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)-N-[(2-methylphenyl)methyl]butanamide
Chemical Structure Depiction of
2-(5-methyl-8-oxofuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)-N-[(2-methylphenyl)methyl]butanamide
2-(5-methyl-8-oxofuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)-N-[(2-methylphenyl)methyl]butanamide
Compound characteristics
| Compound ID: | C794-0239 |
| Compound Name: | 2-(5-methyl-8-oxofuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)-N-[(2-methylphenyl)methyl]butanamide |
| Molecular Weight: | 378.43 |
| Molecular Formula: | C21 H22 N4 O3 |
| Smiles: | CCC(C(NCc1ccccc1C)=O)N1C(c2cc3c(cco3)n2C(C)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5272 |
| logD: | 3.5272 |
| logSw: | -3.533 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.65 |
| InChI Key: | SJRFNELGCZKQGA-INIZCTEOSA-N |