2-[(5-ethylthieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
Chemical Structure Depiction of
2-[(5-ethylthieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
2-[(5-ethylthieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
Compound characteristics
| Compound ID: | C794-0411 |
| Compound Name: | 2-[(5-ethylthieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide |
| Molecular Weight: | 414.52 |
| Molecular Formula: | C20 H19 F N4 O S2 |
| Smiles: | CCC(C(Nc1ccccc1F)=O)Sc1c2cc3c(ccs3)n2c(CC)nn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7973 |
| logD: | 4.7901 |
| logSw: | -4.5021 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.979 |
| InChI Key: | OSBFWCZBEZFKNL-INIZCTEOSA-N |