N-(2,5-difluorophenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
N-(2,5-difluorophenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
Compound characteristics
| Compound ID: | C794-0997 |
| Compound Name: | N-(2,5-difluorophenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea |
| Molecular Weight: | 375.44 |
| Molecular Formula: | C19 H19 F2 N3 O S |
| Smiles: | CC(c1c(C)c(C)sc1n1cccc1)NC(Nc1cc(ccc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9518 |
| logD: | 4.9514 |
| logSw: | -4.6179 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.384 |
| InChI Key: | FNAOLXYECWCKDF-LBPRGKRZSA-N |