N-(5-chloro-2-methylphenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
N-(5-chloro-2-methylphenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea
Compound characteristics
| Compound ID: | C794-1009 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-N'-{1-[4,5-dimethyl-2-(1H-pyrrol-1-yl)thiophen-3-yl]ethyl}urea |
| Molecular Weight: | 387.93 |
| Molecular Formula: | C20 H22 Cl N3 O S |
| Smiles: | CC(c1c(C)c(C)sc1n1cccc1)NC(Nc1cc(ccc1C)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2416 |
| logD: | 5.2416 |
| logSw: | -5.6536 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.384 |
| InChI Key: | DWBKPLNUVRCKRO-AWEZNQCLSA-N |