N-(2,4-dimethylphenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carboxamide
N-(2,4-dimethylphenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carboxamide
Compound characteristics
| Compound ID: | C794-1649 |
| Compound Name: | N-(2,4-dimethylphenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carboxamide |
| Molecular Weight: | 473.55 |
| Molecular Formula: | C28 H28 F N3 O3 |
| Smiles: | Cc1ccc(c(C)c1)NC(N1CCC2(CC1)N(Cc1ccccc1F)C(c1ccccc1O2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2858 |
| logD: | 5.2858 |
| logSw: | -5.1835 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.225 |
| InChI Key: | GEPNPIWYLGOZJO-UHFFFAOYSA-N |