N-[(4-chlorophenyl)methyl]-1-[3-(1H-pyrrol-1-yl)thiophene-2-carbonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-1-[3-(1H-pyrrol-1-yl)thiophene-2-carbonyl]piperidine-4-carboxamide
N-[(4-chlorophenyl)methyl]-1-[3-(1H-pyrrol-1-yl)thiophene-2-carbonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C795-0317 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-1-[3-(1H-pyrrol-1-yl)thiophene-2-carbonyl]piperidine-4-carboxamide |
| Molecular Weight: | 427.95 |
| Molecular Formula: | C22 H22 Cl N3 O2 S |
| Smiles: | C1CN(CCC1C(NCc1ccc(cc1)[Cl])=O)C(c1c(ccs1)n1cccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6917 |
| logD: | 3.6917 |
| logSw: | -4.2271 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.003 |
| InChI Key: | WPTFDFLPPCRRSB-UHFFFAOYSA-N |