{1-[(3-fluorophenyl)methyl]-1H-indazol-6-yl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{1-[(3-fluorophenyl)methyl]-1H-indazol-6-yl}(morpholin-4-yl)methanone
{1-[(3-fluorophenyl)methyl]-1H-indazol-6-yl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | C795-2442 |
| Compound Name: | {1-[(3-fluorophenyl)methyl]-1H-indazol-6-yl}(morpholin-4-yl)methanone |
| Molecular Weight: | 339.37 |
| Molecular Formula: | C19 H18 F N3 O2 |
| Smiles: | C1COCCN1C(c1ccc2cnn(Cc3cccc(c3)F)c2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1378 |
| logD: | 2.1378 |
| logSw: | -2.7217 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.227 |
| InChI Key: | OPQXGAVACWTLAZ-UHFFFAOYSA-N |