N-[(3-bromophenyl)methyl]-1-{1-[(3-fluorophenyl)methyl]-1H-benzimidazol-2-yl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(3-bromophenyl)methyl]-1-{1-[(3-fluorophenyl)methyl]-1H-benzimidazol-2-yl}piperidine-4-carboxamide
N-[(3-bromophenyl)methyl]-1-{1-[(3-fluorophenyl)methyl]-1H-benzimidazol-2-yl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C797-0435 |
| Compound Name: | N-[(3-bromophenyl)methyl]-1-{1-[(3-fluorophenyl)methyl]-1H-benzimidazol-2-yl}piperidine-4-carboxamide |
| Molecular Weight: | 521.43 |
| Molecular Formula: | C27 H26 Br F N4 O |
| Smiles: | C1CN(CCC1C(NCc1cccc(c1)[Br])=O)c1nc2ccccc2n1Cc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 5.7529 |
| logD: | 5.7368 |
| logSw: | -5.8199 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.574 |
| InChI Key: | UDTCMDAMEZASDE-UHFFFAOYSA-N |