N-[1-(adamantan-1-yl)ethyl]-2-(4-ethoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-7-carboxamide
Chemical Structure Depiction of
N-[1-(adamantan-1-yl)ethyl]-2-(4-ethoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-7-carboxamide
N-[1-(adamantan-1-yl)ethyl]-2-(4-ethoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-7-carboxamide
Compound characteristics
| Compound ID: | C797-0958 |
| Compound Name: | N-[1-(adamantan-1-yl)ethyl]-2-(4-ethoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-7-carboxamide |
| Molecular Weight: | 499.68 |
| Molecular Formula: | C30 H33 N3 O2 S |
| Smiles: | CCOc1ccc(cc1)c1cn2c3ccc(cc3sc2n1)C(NC(C)C12CC3CC(CC(C3)C2)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.9639 |
| logD: | 6.9456 |
| logSw: | -5.4959 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.678 |
| InChI Key: | QTRZOXBJDRIKRF-JKIDVQQISA-N |