1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C797-1358 |
| Compound Name: | 1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 469.58 |
| Molecular Formula: | C25 H28 F N3 O3 S |
| Smiles: | CC1=C(c2ccc(C)c(C)c2)S(N=C1N1CCC(CC1)C(NCc1ccc(cc1)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8954 |
| logD: | 3.8954 |
| logSw: | -3.8318 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.544 |
| InChI Key: | PCQMMRXRBBQVNC-UHFFFAOYSA-N |