2-(4-ethyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
Chemical Structure Depiction of
2-(4-ethyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
2-(4-ethyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | C797-1442 |
| Compound Name: | 2-(4-ethyl-1-oxo[1,2,4]triazino[4,5-a]indol-2(1H)-yl)-N-[2-(thiophen-2-yl)ethyl]acetamide |
| Molecular Weight: | 380.47 |
| Molecular Formula: | C20 H20 N4 O2 S |
| Smiles: | CCC1=NN(CC(NCCc2cccs2)=O)C(c2cc3ccccc3n12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6734 |
| logD: | 2.6733 |
| logSw: | -3.1894 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.799 |
| InChI Key: | JLOUGEDTVDEPAU-UHFFFAOYSA-N |