N-{3-[benzyl(ethyl)amino]propyl}-4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxobutanamide
Chemical Structure Depiction of
N-{3-[benzyl(ethyl)amino]propyl}-4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxobutanamide
N-{3-[benzyl(ethyl)amino]propyl}-4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxobutanamide
Compound characteristics
| Compound ID: | C798-0987 |
| Compound Name: | N-{3-[benzyl(ethyl)amino]propyl}-4-(10-methoxypyrido[2,3-b][1,4]benzoxazepin-5(6H)-yl)-4-oxobutanamide |
| Molecular Weight: | 502.61 |
| Molecular Formula: | C29 H34 N4 O4 |
| Smiles: | CCN(CCCNC(CCC(N1Cc2cccc(c2Oc2c1cccn2)OC)=O)=O)Cc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.092 |
| logD: | 1.4451 |
| logSw: | -3.3823 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.462 |
| InChI Key: | CDCAAQWEFIQTHR-UHFFFAOYSA-N |