methyl 5-(furan-2-yl)-1-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 5-(furan-2-yl)-1-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-pyrrole-2-carboxylate
methyl 5-(furan-2-yl)-1-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | C799-0182 |
| Compound Name: | methyl 5-(furan-2-yl)-1-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 352.39 |
| Molecular Formula: | C20 H20 N2 O4 |
| Smiles: | Cc1ccc(CNC(Cn2c(ccc2c2ccco2)C(=O)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.232 |
| logD: | 3.232 |
| logSw: | -3.2277 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.395 |
| InChI Key: | MIQDIDGRRVJJHE-UHFFFAOYSA-N |