1-(1-cyclopentyl-2-methyl-1H-benzimidazole-5-sulfonyl)-N-(3,4-dimethylphenyl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-(1-cyclopentyl-2-methyl-1H-benzimidazole-5-sulfonyl)-N-(3,4-dimethylphenyl)piperidine-4-carboxamide
1-(1-cyclopentyl-2-methyl-1H-benzimidazole-5-sulfonyl)-N-(3,4-dimethylphenyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C799-0286 |
| Compound Name: | 1-(1-cyclopentyl-2-methyl-1H-benzimidazole-5-sulfonyl)-N-(3,4-dimethylphenyl)piperidine-4-carboxamide |
| Molecular Weight: | 494.66 |
| Molecular Formula: | C27 H34 N4 O3 S |
| Smiles: | Cc1ccc(cc1C)NC(C1CCN(CC1)S(c1ccc2c(c1)nc(C)n2C1CCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7565 |
| logD: | 4.7563 |
| logSw: | -4.4337 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.689 |
| InChI Key: | UBSQQLZXSUVNIW-UHFFFAOYSA-N |