4-[(3-chlorophenyl)methyl]-2-ethoxypyrido[2,3-b]pyrazin-3(4H)-one
Chemical Structure Depiction of
4-[(3-chlorophenyl)methyl]-2-ethoxypyrido[2,3-b]pyrazin-3(4H)-one
4-[(3-chlorophenyl)methyl]-2-ethoxypyrido[2,3-b]pyrazin-3(4H)-one
Compound characteristics
| Compound ID: | C799-0743 |
| Compound Name: | 4-[(3-chlorophenyl)methyl]-2-ethoxypyrido[2,3-b]pyrazin-3(4H)-one |
| Molecular Weight: | 315.76 |
| Molecular Formula: | C16 H14 Cl N3 O2 |
| Smiles: | CCOC1C(N(Cc2cccc(c2)[Cl])c2c(cccn2)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1679 |
| logD: | 3.1679 |
| logSw: | -3.2648 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.932 |
| InChI Key: | WZCKVAKKDQBPBT-UHFFFAOYSA-N |