ethyl 3-formyl-1-(2-methoxy-2-oxoethyl)-1H-indole-2-carboxylate
Chemical Structure Depiction of
ethyl 3-formyl-1-(2-methoxy-2-oxoethyl)-1H-indole-2-carboxylate
ethyl 3-formyl-1-(2-methoxy-2-oxoethyl)-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C800-0030 |
| Compound Name: | ethyl 3-formyl-1-(2-methoxy-2-oxoethyl)-1H-indole-2-carboxylate |
| Molecular Weight: | 289.29 |
| Molecular Formula: | C15 H15 N O5 |
| Smiles: | CCOC(c1c(C=O)c2ccccc2n1CC(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9915 |
| logD: | 1.9915 |
| logSw: | -2.2977 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.232 |
| InChI Key: | GVALGUKRTWGCIR-UHFFFAOYSA-N |