methyl {5-[(3-chlorophenyl)methyl]-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl}acetate
Chemical Structure Depiction of
methyl {5-[(3-chlorophenyl)methyl]-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl}acetate
methyl {5-[(3-chlorophenyl)methyl]-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl}acetate
Compound characteristics
| Compound ID: | C800-0063 |
| Compound Name: | methyl {5-[(3-chlorophenyl)methyl]-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl}acetate |
| Molecular Weight: | 381.82 |
| Molecular Formula: | C20 H16 Cl N3 O3 |
| Smiles: | COC(CN1C(c2c(C=N1)c1ccccc1n2Cc1cccc(c1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3957 |
| logD: | 3.3957 |
| logSw: | -3.7198 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.922 |
| InChI Key: | HLCFDKWAVCKNQI-UHFFFAOYSA-N |