ethyl 1-(1-ethoxy-1-oxobutan-2-yl)-3-formyl-1H-indole-2-carboxylate
Chemical Structure Depiction of
ethyl 1-(1-ethoxy-1-oxobutan-2-yl)-3-formyl-1H-indole-2-carboxylate
ethyl 1-(1-ethoxy-1-oxobutan-2-yl)-3-formyl-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C800-0137 |
| Compound Name: | ethyl 1-(1-ethoxy-1-oxobutan-2-yl)-3-formyl-1H-indole-2-carboxylate |
| Molecular Weight: | 331.37 |
| Molecular Formula: | C18 H21 N O5 |
| Smiles: | CCC(C(=O)OCC)n1c(C(=O)OCC)c(C=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2628 |
| logD: | 3.2628 |
| logSw: | -3.053 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.687 |
| InChI Key: | AQXMWOIKPCSOLR-AWEZNQCLSA-N |