3-(3,4-dimethoxyphenyl)-N-(11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazolin-2-yl)prop-2-enamide
					Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-N-(11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazolin-2-yl)prop-2-enamide
			3-(3,4-dimethoxyphenyl)-N-(11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazolin-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | C803-0066 | 
| Compound Name: | 3-(3,4-dimethoxyphenyl)-N-(11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazolin-2-yl)prop-2-enamide | 
| Molecular Weight: | 405.45 | 
| Molecular Formula: | C23 H23 N3 O4 | 
| Smiles: | COc1ccc(/C=C/C(Nc2ccc3c(c2)C(N2CCCCC2=N3)=O)=O)cc1OC | 
| Stereo: | ACHIRAL | 
| logP: | 2.8286 | 
| logD: | 2.8281 | 
| logSw: | -3.5351 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 64.527 | 
| InChI Key: | OEKHNMVQPIAKLS-UHFFFAOYSA-N | 
 
				 
				