2-(ethanesulfonyl)-4-(4-methylbenzene-1-sulfonyl)-N-(propan-2-yl)-1,3-thiazol-5-amine
Chemical Structure Depiction of
2-(ethanesulfonyl)-4-(4-methylbenzene-1-sulfonyl)-N-(propan-2-yl)-1,3-thiazol-5-amine
2-(ethanesulfonyl)-4-(4-methylbenzene-1-sulfonyl)-N-(propan-2-yl)-1,3-thiazol-5-amine
Compound characteristics
| Compound ID: | C848-0244 |
| Compound Name: | 2-(ethanesulfonyl)-4-(4-methylbenzene-1-sulfonyl)-N-(propan-2-yl)-1,3-thiazol-5-amine |
| Molecular Weight: | 388.52 |
| Molecular Formula: | C15 H20 N2 O4 S3 |
| Smiles: | CCS(c1nc(c(NC(C)C)s1)S(c1ccc(C)cc1)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3374 |
| logD: | 3.3374 |
| logSw: | -3.7017 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.357 |
| InChI Key: | XKHYXGXOYYZCHV-UHFFFAOYSA-N |