N~2~-methyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)-N-(3-phenylpropyl)glycinamide
Chemical Structure Depiction of
N~2~-methyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)-N-(3-phenylpropyl)glycinamide
N~2~-methyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)-N-(3-phenylpropyl)glycinamide
Compound characteristics
| Compound ID: | C852-0168 |
| Compound Name: | N~2~-methyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)-N-(3-phenylpropyl)glycinamide |
| Molecular Weight: | 417.55 |
| Molecular Formula: | C20 H23 N3 O3 S2 |
| Smiles: | Cc1nc2ccc(cc2s1)S(N(C)CC(NCCCc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5742 |
| logD: | 3.5742 |
| logSw: | -3.95 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.643 |
| InChI Key: | TVXCVOQHUHPDLG-UHFFFAOYSA-N |