N-(2-ethyl-6-methylphenyl)-2-(piperidin-1-yl)-1,3-benzothiazole-6-carboxamide
Chemical Structure Depiction of
N-(2-ethyl-6-methylphenyl)-2-(piperidin-1-yl)-1,3-benzothiazole-6-carboxamide
N-(2-ethyl-6-methylphenyl)-2-(piperidin-1-yl)-1,3-benzothiazole-6-carboxamide
Compound characteristics
| Compound ID: | C858-0686 |
| Compound Name: | N-(2-ethyl-6-methylphenyl)-2-(piperidin-1-yl)-1,3-benzothiazole-6-carboxamide |
| Molecular Weight: | 379.52 |
| Molecular Formula: | C22 H25 N3 O S |
| Smiles: | CCc1cccc(C)c1NC(c1ccc2c(c1)sc(n2)N1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3104 |
| logD: | 5.3093 |
| logSw: | -5.1626 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.922 |
| InChI Key: | NQIQFFHTSRNJLV-UHFFFAOYSA-N |