[4-(2,3-dimethylphenyl)piperazin-1-yl][2-(piperidin-1-yl)-1,3-benzothiazol-6-yl]methanone
Chemical Structure Depiction of
[4-(2,3-dimethylphenyl)piperazin-1-yl][2-(piperidin-1-yl)-1,3-benzothiazol-6-yl]methanone
[4-(2,3-dimethylphenyl)piperazin-1-yl][2-(piperidin-1-yl)-1,3-benzothiazol-6-yl]methanone
Compound characteristics
| Compound ID: | C858-0848 |
| Compound Name: | [4-(2,3-dimethylphenyl)piperazin-1-yl][2-(piperidin-1-yl)-1,3-benzothiazol-6-yl]methanone |
| Molecular Weight: | 434.6 |
| Molecular Formula: | C25 H30 N4 O S |
| Smiles: | Cc1cccc(c1C)N1CCN(CC1)C(c1ccc2c(c1)sc(n2)N1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5349 |
| logD: | 5.5339 |
| logSw: | -5.2627 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 32.834 |
| InChI Key: | KEEIHIWGICOYNX-UHFFFAOYSA-N |