N-(5-chloro-2,4-dimethoxyphenyl)-2-(morpholin-4-yl)-1,3-benzothiazole-6-carboxamide
					Chemical Structure Depiction of
N-(5-chloro-2,4-dimethoxyphenyl)-2-(morpholin-4-yl)-1,3-benzothiazole-6-carboxamide
			N-(5-chloro-2,4-dimethoxyphenyl)-2-(morpholin-4-yl)-1,3-benzothiazole-6-carboxamide
Compound characteristics
| Compound ID: | C858-1509 | 
| Compound Name: | N-(5-chloro-2,4-dimethoxyphenyl)-2-(morpholin-4-yl)-1,3-benzothiazole-6-carboxamide | 
| Molecular Weight: | 433.91 | 
| Molecular Formula: | C20 H20 Cl N3 O4 S | 
| Smiles: | COc1cc(c(cc1NC(c1ccc2c(c1)sc(n2)N1CCOCC1)=O)[Cl])OC | 
| Stereo: | ACHIRAL | 
| logP: | 4.1174 | 
| logD: | 3.9365 | 
| logSw: | -4.5031 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 58.789 | 
| InChI Key: | VAVCTOVQSHHWDU-UHFFFAOYSA-N | 
 
				 
				