N-[3-(4-ethylpiperazin-1-yl)propyl]-4-(2-oxo-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)butanamide
Chemical Structure Depiction of
N-[3-(4-ethylpiperazin-1-yl)propyl]-4-(2-oxo-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)butanamide
N-[3-(4-ethylpiperazin-1-yl)propyl]-4-(2-oxo-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)butanamide
Compound characteristics
| Compound ID: | C862-0813 |
| Compound Name: | N-[3-(4-ethylpiperazin-1-yl)propyl]-4-(2-oxo-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)butanamide |
| Molecular Weight: | 405.56 |
| Molecular Formula: | C20 H31 N5 O2 S |
| Smiles: | CCN1CCN(CCCNC(CCCN2C(CSc3c2cccn3)=O)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | -0.4411 |
| logD: | -1.3893 |
| logSw: | -1.9514 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.482 |
| InChI Key: | DIFXLHIEPBUIJF-UHFFFAOYSA-N |