N-(3-fluorophenyl)-2-(2-{[(3-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-2-(2-{[(3-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
N-(3-fluorophenyl)-2-(2-{[(3-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Compound characteristics
| Compound ID: | C875-0314 |
| Compound Name: | N-(3-fluorophenyl)-2-(2-{[(3-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide |
| Molecular Weight: | 410.44 |
| Molecular Formula: | C21 H16 F2 N4 O S |
| Smiles: | C(C(Nc1cccc(c1)F)=O)n1c2cnccc2nc1SCc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 4.704 |
| logD: | 4.6909 |
| logSw: | -4.5537 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.145 |
| InChI Key: | WKPMUXCGYKKDIY-UHFFFAOYSA-N |