N-(3,4-dimethoxyphenyl)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
N-(3,4-dimethoxyphenyl)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Compound characteristics
| Compound ID: | C875-0373 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide |
| Molecular Weight: | 452.51 |
| Molecular Formula: | C23 H21 F N4 O3 S |
| Smiles: | COc1ccc(cc1OC)NC(Cn1c2cnccc2nc1SCc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7149 |
| logD: | 3.702 |
| logSw: | -3.7444 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.405 |
| InChI Key: | CKGKIPRSXRHCKN-UHFFFAOYSA-N |