N-(2-methoxyphenyl)-2-(2-{[(3-methoxyphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)butanamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-(2-{[(3-methoxyphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)butanamide
N-(2-methoxyphenyl)-2-(2-{[(3-methoxyphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)butanamide
Compound characteristics
| Compound ID: | C875-0581 |
| Compound Name: | N-(2-methoxyphenyl)-2-(2-{[(3-methoxyphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)butanamide |
| Molecular Weight: | 462.57 |
| Molecular Formula: | C25 H26 N4 O3 S |
| Smiles: | CCC(C(Nc1ccccc1OC)=O)n1c2cnccc2nc1SCc1cccc(c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9884 |
| logD: | 4.9869 |
| logSw: | -4.4631 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.115 |
| InChI Key: | LIOYQNJGRIUQNE-NRFANRHFSA-N |