N-(2,4-dimethylphenyl)-2-(2-{[(2-methylphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-(2-{[(2-methylphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
N-(2,4-dimethylphenyl)-2-(2-{[(2-methylphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide
Compound characteristics
| Compound ID: | C875-0800 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-(2-{[(2-methylphenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)acetamide |
| Molecular Weight: | 416.54 |
| Molecular Formula: | C24 H24 N4 O S |
| Smiles: | Cc1ccc(c(C)c1)NC(Cn1c2cnccc2nc1SCc1ccccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7113 |
| logD: | 5.6985 |
| logSw: | -5.1528 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.447 |
| InChI Key: | FRPZKWTYLSISGE-UHFFFAOYSA-N |