2-{[(3-chlorophenyl)methyl]sulfanyl}-3-[(2,4,6-trimethylphenyl)methyl]-3H-imidazo[4,5-c]pyridine
Chemical Structure Depiction of
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-[(2,4,6-trimethylphenyl)methyl]-3H-imidazo[4,5-c]pyridine
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-[(2,4,6-trimethylphenyl)methyl]-3H-imidazo[4,5-c]pyridine
Compound characteristics
| Compound ID: | C875-0906 |
| Compound Name: | 2-{[(3-chlorophenyl)methyl]sulfanyl}-3-[(2,4,6-trimethylphenyl)methyl]-3H-imidazo[4,5-c]pyridine |
| Molecular Weight: | 407.96 |
| Molecular Formula: | C23 H22 Cl N3 S |
| Smiles: | Cc1cc(C)c(Cn2c3cnccc3nc2SCc2cccc(c2)[Cl])c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 7.0519 |
| logD: | 6.9624 |
| logSw: | -6.5352 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 19.9952 |
| InChI Key: | MOBGAIXDKJRGFA-UHFFFAOYSA-N |