{4-[(2-{[(2-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]phenyl}(piperidin-1-yl)methanone
Chemical Structure Depiction of
{4-[(2-{[(2-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]phenyl}(piperidin-1-yl)methanone
{4-[(2-{[(2-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]phenyl}(piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | C878-2132 |
| Compound Name: | {4-[(2-{[(2-fluorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]phenyl}(piperidin-1-yl)methanone |
| Molecular Weight: | 460.57 |
| Molecular Formula: | C26 H25 F N4 O S |
| Smiles: | C1CCN(CC1)C(c1ccc(Cn2c3cnccc3nc2SCc2ccccc2F)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.04 |
| logD: | 5.0381 |
| logSw: | -4.6184 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.644 |
| InChI Key: | OXEUXFFSWPTRLQ-UHFFFAOYSA-N |