2,5-dimethyl-4-{[(4-methylcyclohexyl)amino]methyl}-1-[(3-methylphenyl)methyl]-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
2,5-dimethyl-4-{[(4-methylcyclohexyl)amino]methyl}-1-[(3-methylphenyl)methyl]-1H-pyrrole-3-carboxylic acid
2,5-dimethyl-4-{[(4-methylcyclohexyl)amino]methyl}-1-[(3-methylphenyl)methyl]-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | C879-0632 |
| Compound Name: | 2,5-dimethyl-4-{[(4-methylcyclohexyl)amino]methyl}-1-[(3-methylphenyl)methyl]-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 368.52 |
| Molecular Formula: | C23 H32 N2 O2 |
| Smiles: | CC1CCC(CC1)NCc1c(C(O)=O)c(C)n(Cc2cccc(C)c2)c1C |
| Stereo: | ACHIRAL |
| logP: | 5.3575 |
| logD: | 5.3575 |
| logSw: | -5.256 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.626 |
| InChI Key: | IJBGCHDNWIECCY-UHFFFAOYSA-N |