1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[({2-[4-(methylsulfanyl)phenyl]ethyl}amino)methyl]-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[({2-[4-(methylsulfanyl)phenyl]ethyl}amino)methyl]-1H-pyrrole-3-carboxylic acid
1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[({2-[4-(methylsulfanyl)phenyl]ethyl}amino)methyl]-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | C879-1576 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-2,5-dimethyl-4-[({2-[4-(methylsulfanyl)phenyl]ethyl}amino)methyl]-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 443.01 |
| Molecular Formula: | C24 H27 Cl N2 O2 S |
| Smiles: | Cc1c(CNCCc2ccc(cc2)SC)c(C(O)=O)c(C)n1Cc1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.8153 |
| logD: | 4.8153 |
| logSw: | -4.5693 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.951 |
| InChI Key: | GAWAMVQGILURFG-UHFFFAOYSA-N |