N-(3-fluorophenyl)-2-(5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl)acetamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-2-(5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl)acetamide
N-(3-fluorophenyl)-2-(5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl)acetamide
Compound characteristics
| Compound ID: | C880-0109 |
| Compound Name: | N-(3-fluorophenyl)-2-(5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indol-3-yl)acetamide |
| Molecular Weight: | 350.35 |
| Molecular Formula: | C19 H15 F N4 O2 |
| Smiles: | Cn1c2C(N(CC(Nc3cccc(c3)F)=O)N=Cc2c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5508 |
| logD: | 2.5507 |
| logSw: | -3.0109 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.303 |
| InChI Key: | SQYBJTVBTGFCFF-UHFFFAOYSA-N |