N-(4-chlorophenyl)-1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
N-(4-chlorophenyl)-1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | C883-0087 |
| Compound Name: | N-(4-chlorophenyl)-1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 362.82 |
| Molecular Formula: | C20 H15 Cl N4 O |
| Smiles: | c1ccc(cc1)n1c(c(cn1)C(Nc1ccc(cc1)[Cl])=O)n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0834 |
| logD: | 5.0833 |
| logSw: | -5.3945 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.186 |
| InChI Key: | IEDSPRZFGVIEAV-UHFFFAOYSA-N |