N-(butan-2-yl)-4-(5,7-dimethyl-1-oxo-2-phenyl-1,2-dihydro-6H-pyrrolo[3,4-d]pyridazin-6-yl)butanamide
Chemical Structure Depiction of
N-(butan-2-yl)-4-(5,7-dimethyl-1-oxo-2-phenyl-1,2-dihydro-6H-pyrrolo[3,4-d]pyridazin-6-yl)butanamide
N-(butan-2-yl)-4-(5,7-dimethyl-1-oxo-2-phenyl-1,2-dihydro-6H-pyrrolo[3,4-d]pyridazin-6-yl)butanamide
Compound characteristics
| Compound ID: | C890-0842 |
| Compound Name: | N-(butan-2-yl)-4-(5,7-dimethyl-1-oxo-2-phenyl-1,2-dihydro-6H-pyrrolo[3,4-d]pyridazin-6-yl)butanamide |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C22 H28 N4 O2 |
| Smiles: | CCC(C)NC(CCCn1c(C)c2C=NN(C(c2c1C)=O)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0508 |
| logD: | 2.0483 |
| logSw: | -2.5144 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.671 |
| InChI Key: | GJVSHMOYQMFBOZ-HNNXBMFYSA-N |