N-(3,4-dimethoxyphenyl)-7-ethyl-1,7-dimethyl-9-oxo-8,9-dihydro-7H-furo[3,2-f][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-7-ethyl-1,7-dimethyl-9-oxo-8,9-dihydro-7H-furo[3,2-f][1]benzopyran-2-carboxamide
N-(3,4-dimethoxyphenyl)-7-ethyl-1,7-dimethyl-9-oxo-8,9-dihydro-7H-furo[3,2-f][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C893-0816 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-7-ethyl-1,7-dimethyl-9-oxo-8,9-dihydro-7H-furo[3,2-f][1]benzopyran-2-carboxamide |
| Molecular Weight: | 423.46 |
| Molecular Formula: | C24 H25 N O6 |
| Smiles: | CCC1(C)CC(c2c(ccc3c2c(C)c(C(Nc2ccc(c(c2)OC)OC)=O)o3)O1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0882 |
| logD: | 4.0846 |
| logSw: | -4.8042 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.892 |
| InChI Key: | DOZAJGALZWJTIT-DEOSSOPVSA-N |