ethyl 1-(7-chloro-5,5-dioxo-4,5-dihydro-5lambda~6~-thieno[3,2-c][1]benzothiopyran-2-carbonyl)piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-(7-chloro-5,5-dioxo-4,5-dihydro-5lambda~6~-thieno[3,2-c][1]benzothiopyran-2-carbonyl)piperidine-3-carboxylate
ethyl 1-(7-chloro-5,5-dioxo-4,5-dihydro-5lambda~6~-thieno[3,2-c][1]benzothiopyran-2-carbonyl)piperidine-3-carboxylate
Compound characteristics
| Compound ID: | C918-0064 |
| Compound Name: | ethyl 1-(7-chloro-5,5-dioxo-4,5-dihydro-5lambda~6~-thieno[3,2-c][1]benzothiopyran-2-carbonyl)piperidine-3-carboxylate |
| Molecular Weight: | 453.96 |
| Molecular Formula: | C20 H20 Cl N O5 S2 |
| Smiles: | CCOC(C1CCCN(C1)C(c1cc2CS(c3cc(ccc3c2s1)[Cl])(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7454 |
| logD: | 3.7454 |
| logSw: | -4.1719 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 66.767 |
| InChI Key: | LWPRCGSWMDHUGP-LBPRGKRZSA-N |