7-chloro-N-(2-methoxy-5-methylphenyl)-N-methyl-4H-thieno[3,2-c][1]benzothiopyran-2-carboxamide
Chemical Structure Depiction of
7-chloro-N-(2-methoxy-5-methylphenyl)-N-methyl-4H-thieno[3,2-c][1]benzothiopyran-2-carboxamide
7-chloro-N-(2-methoxy-5-methylphenyl)-N-methyl-4H-thieno[3,2-c][1]benzothiopyran-2-carboxamide
Compound characteristics
| Compound ID: | C918-0341 |
| Compound Name: | 7-chloro-N-(2-methoxy-5-methylphenyl)-N-methyl-4H-thieno[3,2-c][1]benzothiopyran-2-carboxamide |
| Molecular Weight: | 415.96 |
| Molecular Formula: | C21 H18 Cl N O2 S2 |
| Smiles: | Cc1ccc(c(c1)N(C)C(c1cc2CSc3cc(ccc3c2s1)[Cl])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.6825 |
| logD: | 5.6825 |
| logSw: | -5.8248 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 23.6043 |
| InChI Key: | KRYBMZBXXJZIIO-UHFFFAOYSA-N |