3-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-3-(1H-pyrrol-1-yl)propanamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-3-(1H-pyrrol-1-yl)propanamide
3-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-3-(1H-pyrrol-1-yl)propanamide
Compound characteristics
| Compound ID: | C920-0414 |
| Compound Name: | 3-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-3-(1H-pyrrol-1-yl)propanamide |
| Molecular Weight: | 364.44 |
| Molecular Formula: | C22 H24 N2 O3 |
| Smiles: | COc1ccc(cc1)C(CC(NCc1cccc(c1)OC)=O)n1cccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.734 |
| logD: | 3.734 |
| logSw: | -4.0606 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.049 |
| InChI Key: | TZQVDAUJMBYNOU-NRFANRHFSA-N |