N-(2,6-diethylphenyl)-3-(1,4-dimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl)propanamide
Chemical Structure Depiction of
N-(2,6-diethylphenyl)-3-(1,4-dimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl)propanamide
N-(2,6-diethylphenyl)-3-(1,4-dimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl)propanamide
Compound characteristics
| Compound ID: | C920-1194 |
| Compound Name: | N-(2,6-diethylphenyl)-3-(1,4-dimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl)propanamide |
| Molecular Weight: | 457.55 |
| Molecular Formula: | C23 H27 N3 O5 S |
| Smiles: | CCc1cccc(CC)c1NC(CCS(c1ccc2c(c1)N(C)C(C(N2C)=O)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6629 |
| logD: | 1.6629 |
| logSw: | -2.5707 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.116 |
| InChI Key: | MECZCAZPGDIAOJ-UHFFFAOYSA-N |