N-(2,3-dimethylphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
N-(2,3-dimethylphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Compound characteristics
| Compound ID: | C987-0040 |
| Compound Name: | N-(2,3-dimethylphenyl)-3-[3,4,6-trimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide |
| Molecular Weight: | 426.56 |
| Molecular Formula: | C27 H30 N4 O |
| Smiles: | Cc1ccc(cc1)n1c2c(c(C)c(CCC(Nc3cccc(C)c3C)=O)c(C)n2)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.588 |
| logD: | 5.5858 |
| logSw: | -5.7077 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.391 |
| InChI Key: | UIAOXJLQRCGTRB-UHFFFAOYSA-N |