4-butoxy-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide
Chemical Structure Depiction of
4-butoxy-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide
4-butoxy-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide
Compound characteristics
| Compound ID: | C991-0104 |
| Compound Name: | 4-butoxy-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide |
| Molecular Weight: | 343.45 |
| Molecular Formula: | C18 H21 N3 O2 S |
| Smiles: | CCCCOc1ccc(cc1)C(NCc1cn2c(C)csc2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6434 |
| logD: | 3.6433 |
| logSw: | -3.5911 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.264 |
| InChI Key: | LZSFWTGFQNKPLG-UHFFFAOYSA-N |