4-methyl-4-[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]-1-[(4-propoxyphenyl)methyl]piperidine
Chemical Structure Depiction of
4-methyl-4-[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]-1-[(4-propoxyphenyl)methyl]piperidine
4-methyl-4-[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]-1-[(4-propoxyphenyl)methyl]piperidine
Compound characteristics
| Compound ID: | CM3759-3349 |
| Compound Name: | 4-methyl-4-[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]-1-[(4-propoxyphenyl)methyl]piperidine |
| Molecular Weight: | 399.53 |
| Molecular Formula: | C23 H33 N3 O3 |
| Smiles: | CCCOc1ccc(CN2CCC(C)(CC2)c2nc(C3CCOCC3)on2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8466 |
| logD: | 4.1504 |
| logSw: | -4.4531 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.895 |
| InChI Key: | FFPJTORAYLFMOY-UHFFFAOYSA-N |