N-(1,2,3-benzothiadiazol-5-yl)-N'-(4-ethoxyphenyl)urea
					Chemical Structure Depiction of
N-(1,2,3-benzothiadiazol-5-yl)-N'-(4-ethoxyphenyl)urea
			N-(1,2,3-benzothiadiazol-5-yl)-N'-(4-ethoxyphenyl)urea
Compound characteristics
| Compound ID: | D003-0020 | 
| Compound Name: | N-(1,2,3-benzothiadiazol-5-yl)-N'-(4-ethoxyphenyl)urea | 
| Molecular Weight: | 314.36 | 
| Molecular Formula: | C15 H14 N4 O2 S | 
| Smiles: | CCOc1ccc(cc1)NC(Nc1ccc2c(c1)nns2)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.0353 | 
| logD: | 4.0353 | 
| logSw: | -4.0515 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 61.246 | 
| InChI Key: | UWUGYLXWIXHZLP-UHFFFAOYSA-N | 
 
				 
				