N-(3-nitrophenyl)-1,2,3-benzothiadiazole-5-carboxamide
Chemical Structure Depiction of
N-(3-nitrophenyl)-1,2,3-benzothiadiazole-5-carboxamide
N-(3-nitrophenyl)-1,2,3-benzothiadiazole-5-carboxamide
Compound characteristics
| Compound ID: | D003-0024 |
| Compound Name: | N-(3-nitrophenyl)-1,2,3-benzothiadiazole-5-carboxamide |
| Molecular Weight: | 300.29 |
| Molecular Formula: | C13 H8 N4 O3 S |
| Smiles: | c1cc(cc(c1)[N+]([O-])=O)NC(c1ccc2c(c1)nns2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.994 |
| logD: | 2.9613 |
| logSw: | -3.5555 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.293 |
| InChI Key: | MBJXONHVGQZRPW-UHFFFAOYSA-N |