N-[3-(dipropylamino)-1-(1-ethyl-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[3-(dipropylamino)-1-(1-ethyl-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
N-[3-(dipropylamino)-1-(1-ethyl-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | D009-0265 |
| Compound Name: | N-[3-(dipropylamino)-1-(1-ethyl-1H-indol-3-yl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| Molecular Weight: | 435.54 |
| Molecular Formula: | C26 H30 F N3 O2 |
| Smiles: | CCCN(CCC)C(/C(=C/c1cn(CC)c2ccccc12)NC(c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8022 |
| logD: | 3.1408 |
| logSw: | -4.6007 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.331 |
| InChI Key: | ZDHGRKNWGUBZBE-UHFFFAOYSA-N |